cas: 1446282-18-3 — see every product listed under this CAS number, including other names
4,7,10,13,16-Pentaoxaoctadecanoic acid, 18-amino-, 1,1-dimethylethyl ester, 98%, 98% (CAS 1446282-18-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112JV9-100mg |
| cas | 1446282-18-3 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1302.80 Pln | |
| Chemat | 25g | 2334.80 Pln | |
| Chemat | 50g | 3851.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1446282-18-3) is a chemical compound with the molecular formula C17H35NO7 and a molecular weight of 365.5 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: XSTIRQZQKAJSIM-UHFFFAOYSA-N.
| Molecular formula | C17H35NO7 |
|---|---|
| Molecular weight | 365.5 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | XSTIRQZQKAJSIM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)