CAS 18711-13-2 appears in our catalog under these names: 4,7–Dichloroisatin, 4,7-Dichloroisatin, 98% , 4,7-Dichloroisatin, 4,7-Dichloroindoline-2,3-dione 95%, 4,7-Dichloroindoline-2,3-dione, 95%, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 10g, 1000g, 2000g, 100g.
4,7-dichloro-1H-indole-2,3-dione (CAS 18711-13-2) is a chemical compound with the molecular formula C8H3Cl2NO2 and a molecular weight of 216.02 g/mol. IUPAC name: 4,7-dichloro-1H-indole-2,3-dione. InChIKey: NUXYYWOWNFEMNH-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 4,7-dichloro-1H-indole-2,3-dione |
| InChIKey | NUXYYWOWNFEMNH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)C(=O)C(=O)N2)Cl |
Computed by PubChem (NCBI)