Products 1677-47-0
CAS 1677-47-0 appears in our catalog under these names: 4,5-Dichloroisatin, 4,5-Dichloroisatin, 95%, 95%, 4,5-Dichloroindoline-2,3-dione, 97%, 4,5-Dichloroisatin, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,5g, 0,25g, 1g, 2g, 100mg, 250mg, 5g.
4,5-dichloro-1H-indole-2,3-dione (CAS 1677-47-0) is a chemical compound with the molecular formula C8H3Cl2NO2 and a molecular weight of 216.02 g/mol. IUPAC name: 4,5-dichloro-1H-indole-2,3-dione. InChIKey: WWSWHYAXEFLETD-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 4,5-dichloro-1H-indole-2,3-dione |
| InChIKey | WWSWHYAXEFLETD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NC(=O)C2=O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
4,5-dichloro-1H-indole-2,3-dione, 4,5-dichloro-2,3-dihydro-1H-indole-2,3-dione, 4,5-Dichloroisatin, 4,5-Dichloroindoline-2,3-dione, 1H-Indole-2,3-dione, 4,5-dichloro-, 4,5-Dichlorisatin, 4,5-dichloro-1H-indol-2,3-dione, Isatin-based compou, Isatin-based compound, 49, WWSWHYAXEFLETD-UHFFFAOYSA-N