cas: 54557-81-2 — see every product listed under this CAS number, including other names
4–(3,4–(Ethylenedioxy)phenyl)–4–oxobutyric acid (CAS 54557-81-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 50mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD12364-1g |
| cas | 54557-81-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 887.23 Pln | |
| GLPBio | 250mg | 700.01 Pln | |
| GLPBio | 50mg | 508.11 Pln | |
| GLPBio | 5g | 2581.57 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanoic acid (CAS 54557-81-2) is a chemical compound with the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. IUPAC name: 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanoic acid. InChIKey: LMDXEMFSAHAGGP-UHFFFAOYSA-N.
| Molecular formula | C12H12O5 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanoic acid |
| InChIKey | LMDXEMFSAHAGGP-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)