cas: 54557-81-2 — see every product listed under this CAS number, including other names
4-(2,3-Dihydro-1,4-benzodioxin-6-yl)-4-oxobutanoic acid, 97% (CAS 54557-81-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | BTB12838DA |
| cas | 54557-81-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 294.25 Pln | |
| Thermo Scientific | 10g | 1033.43 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanoic acid (CAS 54557-81-2) is a chemical compound with the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. IUPAC name: 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanoic acid. InChIKey: LMDXEMFSAHAGGP-UHFFFAOYSA-N.
| Molecular formula | C12H12O5 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanoic acid |
| InChIKey | LMDXEMFSAHAGGP-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)