4–Thiothymidine
cas: 7236-57-9 — see every product listed under this CAS number, including other names
4–Thiothymidine (CAS 7236-57-9) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 500mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC77043-10 |
| cas | 7236-57-9 |
| size | 10mg |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 550.23 Pln | |
| GLPBio | 100mg | 919.99 Pln | |
| GLPBio | 25mg | 625.12 Pln | |
| GLPBio | 5mg | 512.79 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 522.15 Pln | |
| GLPBio | 50mg | 732.77 Pln | |
| GLPBio | 500mg | 1720.36 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one (CAS 7236-57-9) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one. InChIKey: AVKSPBJBGGHUMW-XLPZGREQSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one |
| InChIKey | AVKSPBJBGGHUMW-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)NC1=S)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)