cas: 112809-25-3 — see every product listed under this CAS number, including other names
4-((1H-1,2,4-Triazol-1-yl)methyl)benzonitrile 90% (CAS 112809-25-3) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A636099-500g |
| cas | 112809-25-3 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 28416.50 Pln | |
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 826.50 Pln | |
| Ambeed | 10g | 1366.06 Pln | |
| Ambeed | 25g | 2534.19 Pln | |
| Ambeed | 100g | 7156.62 Pln |
| purity | 90% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A636099 |
4-(1,2,4-triazol-1-ylmethyl)benzonitrile (CAS 112809-25-3) is a chemical compound with the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. IUPAC name: 4-(1,2,4-triazol-1-ylmethyl)benzonitrile. InChIKey: HQLYWHSJALKYOV-UHFFFAOYSA-N.
| Molecular formula | C10H8N4 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | 4-(1,2,4-triazol-1-ylmethyl)benzonitrile |
| InChIKey | HQLYWHSJALKYOV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NC=N2)C#N |
Computed by PubChem (NCBI)