cas: 92952-81-3 — see every product listed under this CAS number, including other names
4-((3-Hydroxypropyl)amino)-3-nitrophenol 95% (CAS 92952-81-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A341372-1g |
| cas | 92952-81-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 259.12 Pln | |
| Ambeed | 100g | 464.94 Pln | |
| Ambeed | 500g | 1666.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A341372 |
4-(3-hydroxypropylamino)-3-nitrophenol (CAS 92952-81-3) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: 4-(3-hydroxypropylamino)-3-nitrophenol. InChIKey: VTXBLQLZQLHDIL-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 4-(3-hydroxypropylamino)-3-nitrophenol |
| InChIKey | VTXBLQLZQLHDIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])NCCCO |
Computed by PubChem (NCBI)