cas: 1948-92-1 — see every product listed under this CAS number, including other names
4-((4-Nitrophenyl)sulfonyl)aniline 97% (CAS 1948-92-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A190168-250mg |
| cas | 1948-92-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 693.00 Pln | |
| Ambeed | 5g | 1850.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A190168 |
4-(4-nitrophenyl)sulfonylaniline (CAS 1948-92-1) is a chemical compound with the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. IUPAC name: 4-(4-nitrophenyl)sulfonylaniline. InChIKey: DMZVYFFBWHBWMO-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O4S |
|---|---|
| Molecular weight | 278.29 g/mol |
| IUPAC name | 4-(4-nitrophenyl)sulfonylaniline |
| InChIKey | DMZVYFFBWHBWMO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)