CAS 121262-07-5 is the registry number for 3-Nitrophenethyl thiazole-4-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(3-nitrophenyl)-1,3-thiazole-4-carboxylate (CAS 121262-07-5) is a chemical compound with the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. IUPAC name: ethyl 2-(3-nitrophenyl)-1,3-thiazole-4-carboxylate. InChIKey: LWGLXPDMTJTNNH-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O4S |
|---|---|
| Molecular weight | 278.29 g/mol |
| IUPAC name | ethyl 2-(3-nitrophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | LWGLXPDMTJTNNH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)