CAS 53101-05-6 appears in our catalog under these names: Ethyl 4-(3-nitrophenyl)-1,3-thiazole-2-carboxylate, 95%, Ethyl 4–(3–Nitrophenyl)thiazole–2–carboxylate, Ethyl 4-(3-Nitrophenyl)thiazole-2-carboxylate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
Ethyl 4-(3-nitrophenyl)-1,3-thiazole-2-carboxylate (CAS 53101-05-6) is a chemical compound with the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. IUPAC name: ethyl 4-(3-nitrophenyl)-1,3-thiazole-2-carboxylate. InChIKey: ORZHIBZDQVVYKZ-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O4S |
|---|---|
| Molecular weight | 278.29 g/mol |
| IUPAC name | ethyl 4-(3-nitrophenyl)-1,3-thiazole-2-carboxylate |
| InChIKey | ORZHIBZDQVVYKZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=CS1)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)