CAS 2918-83-4 appears in our catalog under these names: 4-[(4-Hydroxyphenyl)diazenyl]benzenesulfonic acid, 95%, 4-[(4-Hydroxyphenyl)diazenyl]benzenesulfonic Acid, ≥97%, ≥97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 10g.
4-[(4-hydroxyphenyl)diazenyl]benzenesulfonic acid (CAS 2918-83-4) is a chemical compound with the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. IUPAC name: 4-[(4-hydroxyphenyl)diazenyl]benzenesulfonic acid. InChIKey: CNYMBHPFLJWLJW-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O4S |
|---|---|
| Molecular weight | 278.29 g/mol |
| IUPAC name | 4-[(4-hydroxyphenyl)diazenyl]benzenesulfonic acid |
| InChIKey | CNYMBHPFLJWLJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=NC2=CC=C(C=C2)S(=O)(=O)O)O |
Computed by PubChem (NCBI)