cas: 14180-12-2 — see every product listed under this CAS number, including other names
4-((Butoxycarbonyl)oxy)benzoic acid, 98.0%, 98.0% (CAS 14180-12-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112H8O-1g |
| cas | 14180-12-2 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 150.80 Pln |
| purity | 98.0% |
|---|---|
| delivery time | 3 weeks |
4-butoxycarbonyloxybenzoic acid (CAS 14180-12-2) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: 4-butoxycarbonyloxybenzoic acid. InChIKey: GNBKEARJFHTJMV-UHFFFAOYSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 4-butoxycarbonyloxybenzoic acid |
| InChIKey | GNBKEARJFHTJMV-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)OC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)