cas: 1326229-55-3 — see every product listed under this CAS number, including other names
4-((tert-Butoxycarbonyl)amino)-2-(trifluoromethyl)benzoic acid 95% (CAS 1326229-55-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A172791-100mg |
| cas | 1326229-55-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 1905.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A172791 |
4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(trifluoromethyl)benzoic acid (CAS 1326229-55-3) is a chemical compound with the molecular formula C13H14F3NO4 and a molecular weight of 305.25 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(trifluoromethyl)benzoic acid. InChIKey: FYMDQMINCBZAPK-UHFFFAOYSA-N.
| Molecular formula | C13H14F3NO4 |
|---|---|
| Molecular weight | 305.25 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(trifluoromethyl)benzoic acid |
| InChIKey | FYMDQMINCBZAPK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)