cas: 1326229-55-3 — see every product listed under this CAS number, including other names
4-[(tert-butoxycarbonyl)amino]-2-(trifluoromethyl)benzoic acid, 97% (CAS 1326229-55-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F520995-1G |
| cas | 1326229-55-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2471.02 Pln | |
| Fluorochem | 100mg | 685.19 Pln | |
| Fluorochem | 250mg | 846.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(trifluoromethyl)benzoic acid (CAS 1326229-55-3) is a chemical compound with the molecular formula C13H14F3NO4 and a molecular weight of 305.25 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(trifluoromethyl)benzoic acid. InChIKey: FYMDQMINCBZAPK-UHFFFAOYSA-N.
| Molecular formula | C13H14F3NO4 |
|---|---|
| Molecular weight | 305.25 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(trifluoromethyl)benzoic acid |
| InChIKey | FYMDQMINCBZAPK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)