CAS 1326229-55-3 appears in our catalog under these names: 4-[(tert-Butoxycarbonyl)amino]-2-(trifluoromethyl)benzoic acid, 98%, 4-((tert-Butoxycarbonyl)amino)-2-(trifluoromethyl)benzoic acid 95%, 4-[(tert-butoxycarbonyl)amino]-2-(trifluoromethyl)benzoic acid, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg.
4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(trifluoromethyl)benzoic acid (CAS 1326229-55-3) is a chemical compound with the molecular formula C13H14F3NO4 and a molecular weight of 305.25 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(trifluoromethyl)benzoic acid. InChIKey: FYMDQMINCBZAPK-UHFFFAOYSA-N.
| Molecular formula | C13H14F3NO4 |
|---|---|
| Molecular weight | 305.25 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(trifluoromethyl)benzoic acid |
| InChIKey | FYMDQMINCBZAPK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)