CAS 207508-60-9 is the registry number for (4S)-4-(4-Trifluoromethyl-benzyl)-l-glutamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
(2S,4S)-2-amino-4-[[4-(trifluoromethyl)phenyl]methyl]pentanedioic acid (CAS 207508-60-9) is a chemical compound with the molecular formula C13H14F3NO4 and a molecular weight of 305.25 g/mol. IUPAC name: (2S,4S)-2-amino-4-[[4-(trifluoromethyl)phenyl]methyl]pentanedioic acid. InChIKey: DGVMWWMTSDUMAQ-WPRPVWTQSA-N.
| Molecular formula | C13H14F3NO4 |
|---|---|
| Molecular weight | 305.25 g/mol |
| IUPAC name | (2S,4S)-2-amino-4-[[4-(trifluoromethyl)phenyl]methyl]pentanedioic acid |
| InChIKey | DGVMWWMTSDUMAQ-WPRPVWTQSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C[C@@H](C(=O)O)N)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)