cas: 40681-88-7 — see every product listed under this CAS number, including other names
4-(1,3-dioxolan-2-yl)benzaldehyde, 95%, 95% (CAS 40681-88-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CKNB-100mg |
| cas | 40681-88-7 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 573.20 Pln | |
| Chemat | 250mg | 784.40 Pln | |
| Chemat | 1g | 1494.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(1,3-dioxolan-2-yl)benzaldehyde (CAS 40681-88-7) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 4-(1,3-dioxolan-2-yl)benzaldehyde. InChIKey: XXTKORQHKOYXIH-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 4-(1,3-dioxolan-2-yl)benzaldehyde |
| InChIKey | XXTKORQHKOYXIH-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)