CAS 4219-55-0 appears in our catalog under these names: 4-Propanoylbenzoic acid, 96%, 4-Propionylbenzoic acid, 98%, 4-Propionylbenzoic acid, 4-propanoylbenzoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 100mg, 2.5g.
4-propanoylbenzoic acid (CAS 4219-55-0) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 4-propanoylbenzoic acid. InChIKey: MQZBJHMHKZVYHB-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 4-propanoylbenzoic acid |
| InChIKey | MQZBJHMHKZVYHB-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)