cas: 495-62-5 — see every product listed under this CAS number, including other names
4-(1,5-Dimethyl-4-hexen-1-ylidene)-1-methylcyclohexene, 95%(mixture of isomers), 95%(mixture of isomers) (CAS 495-62-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145JB-1g |
| cas | 495-62-5 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 25g | 582.80 Pln | |
| Chemat | 100g | 1797.20 Pln | |
| Chemat | 500g | 6240.00 Pln |
| purity | 95%(mixture of isomers) |
|---|---|
| delivery time | 3 weeks |
1-methyl-4-(6-methylhept-5-en-2-ylidene)cyclohexene (CAS 495-62-5) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: 1-methyl-4-(6-methylhept-5-en-2-ylidene)cyclohexene. InChIKey: XBGUIVFBMBVUEG-UHFFFAOYSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | 1-methyl-4-(6-methylhept-5-en-2-ylidene)cyclohexene |
| InChIKey | XBGUIVFBMBVUEG-UHFFFAOYSA-N |
| SMILES | CC1=CCC(=C(C)CCC=C(C)C)CC1 |
Computed by PubChem (NCBI)