cas: 495-62-5 — see every product listed under this CAS number, including other names
Bisabolene (mixture of isomers) (CAS 495-62-5) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-121262-5 g |
| cas | 495-62-5 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 551.89 Pln | |
| MedChemExpress | 1 g | 263.96 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | no data |
1-methyl-4-(6-methylhept-5-en-2-ylidene)cyclohexene (CAS 495-62-5) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: 1-methyl-4-(6-methylhept-5-en-2-ylidene)cyclohexene. InChIKey: XBGUIVFBMBVUEG-UHFFFAOYSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | 1-methyl-4-(6-methylhept-5-en-2-ylidene)cyclohexene |
| InChIKey | XBGUIVFBMBVUEG-UHFFFAOYSA-N |
| SMILES | CC1=CCC(=C(C)CCC=C(C)C)CC1 |
Computed by PubChem (NCBI)