cas: 1256360-30-1 — see every product listed under this CAS number, including other names
4-(1-Hydroxy-2-methylpropyl)phenylboronic acid pinacol ester, 96%, 96% (CAS 1256360-30-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110BQO-1g |
| cas | 1256360-30-1 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 712.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-ol (CAS 1256360-30-1) is a chemical compound with the molecular formula C16H25BO3 and a molecular weight of 276.2 g/mol. IUPAC name: 2-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-ol. InChIKey: XEDOTLRWWKUYQW-UHFFFAOYSA-N.
| Molecular formula | C16H25BO3 |
|---|---|
| Molecular weight | 276.2 g/mol |
| IUPAC name | 2-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-1-ol |
| InChIKey | XEDOTLRWWKUYQW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(C(C)C)O |
Computed by PubChem (NCBI)