cas: 2562-71-2 — see every product listed under this CAS number, including other names
4-(1H-Benzo[d]imidazol-2-yl)-N,N-dimethylaniline 95% (CAS 2562-71-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A273250-100mg |
| cas | 2562-71-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1143.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A273250 |
4-(1H-benzimidazol-2-yl)-N,N-dimethylaniline (CAS 2562-71-2) is a chemical compound with the molecular formula C15H15N3 and a molecular weight of 237.30 g/mol. IUPAC name: 4-(1H-benzimidazol-2-yl)-N,N-dimethylaniline. InChIKey: ZKBBGUJBGLTNEK-UHFFFAOYSA-N.
| Molecular formula | C15H15N3 |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | 4-(1H-benzimidazol-2-yl)-N,N-dimethylaniline |
| InChIKey | ZKBBGUJBGLTNEK-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)