CAS 60603-62-5 is the registry number for 1-(1H-1,3-Benzodiazol-2-yl)-2-phenylethan-1-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(1H-benzimidazol-2-yl)-2-phenylethanamine (CAS 60603-62-5) is a chemical compound with the molecular formula C15H15N3 and a molecular weight of 237.30 g/mol. IUPAC name: 1-(1H-benzimidazol-2-yl)-2-phenylethanamine. InChIKey: XUKFUDAFEGNTRD-UHFFFAOYSA-N.
| Molecular formula | C15H15N3 |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | 1-(1H-benzimidazol-2-yl)-2-phenylethanamine |
| InChIKey | XUKFUDAFEGNTRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C2=NC3=CC=CC=C3N2)N |
Computed by PubChem (NCBI)