Products 866019-99-0
CAS 866019-99-0 is the registry number for (2E)-3-(Dimethylamino)-2-[4-(1h-pyrrol-1-yl)phenyl]prop-2-enenitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-3-(dimethylamino)-2-(4-pyrrol-1-ylphenyl)prop-2-enenitrile (CAS 866019-99-0) is a chemical compound with the molecular formula C15H15N3 and a molecular weight of 237.30 g/mol. IUPAC name: (E)-3-(dimethylamino)-2-(4-pyrrol-1-ylphenyl)prop-2-enenitrile. InChIKey: YQWIBMUHHRKKOI-OWBHPGMISA-N.
| Molecular formula | C15H15N3 |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-2-(4-pyrrol-1-ylphenyl)prop-2-enenitrile |
| InChIKey | YQWIBMUHHRKKOI-OWBHPGMISA-N |
| SMILES | CN(C)/C=C(/C#N)\C1=CC=C(C=C1)N2C=CC=C2 |
Computed by PubChem (NCBI)