CAS 2562-71-2 appears in our catalog under these names: 2-(P-N,N-Dimethylaminophenyl)-1h-benzoimidazole, 95%, 4-(1H-benzo(d)imidazol-2-yl)-N,N-dimethylaniline, 4-(1H-Benzo[d]imidazol-2-yl)-N,N-dimethylaniline 95%, 4-(1H-Benzo[d]imidazol-2-yl)-N,N-dimethylaniline, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 50mg, 0,5g, 100mg.
4-(1H-benzimidazol-2-yl)-N,N-dimethylaniline (CAS 2562-71-2) is a chemical compound with the molecular formula C15H15N3 and a molecular weight of 237.30 g/mol. IUPAC name: 4-(1H-benzimidazol-2-yl)-N,N-dimethylaniline. InChIKey: ZKBBGUJBGLTNEK-UHFFFAOYSA-N.
| Molecular formula | C15H15N3 |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | 4-(1H-benzimidazol-2-yl)-N,N-dimethylaniline |
| InChIKey | ZKBBGUJBGLTNEK-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)