4-(1H-Indol-1-yl)aniline, 95%
cas: 938018-12-3 — see every product listed under this CAS number, including other names
4-(1H-Indol-1-yl)aniline, 95% (CAS 938018-12-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1073938-100mg |
| cas | 938018-12-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 370.38 Pln | |
| Ambeed | 250mg | 520.56 Pln | |
| Ambeed | 1g | 971.12 Pln | |
| Ambeed | 5g | 3674.50 Pln | |
| BLDpharm | 100mg | 397.66 Pln | |
| BLDpharm | 250mg | 553.16 Pln | |
| BLDpharm | 1g | 1041.88 Pln | |
| BLDpharm | 5g | 3957.52 Pln | |
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 496.40 Pln | |
| Chemat | 1g | 933.20 Pln | |
| Chemat | 5g | 3534.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-indol-1-ylaniline (CAS 938018-12-3) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 4-indol-1-ylaniline. InChIKey: NZQHJRPNILETRB-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 4-indol-1-ylaniline |
| InChIKey | NZQHJRPNILETRB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN2C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)