4-(1H-Indol-2-yl)aniline, 95%
cas: 21889-05-4 — see every product listed under this CAS number, including other names
4-(1H-Indol-2-yl)aniline, 95% (CAS 21889-05-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A310239-100mg |
| cas | 21889-05-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 615.13 Pln | |
| Ambeed | 1g | 1393.88 Pln | |
| BLDpharm | 100mg | 436.54 Pln | |
| BLDpharm | 250mg | 658.68 Pln | |
| BLDpharm | 1g | 1497.28 Pln | |
| Chemat | 50mg | 179.60 Pln | |
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 976.40 Pln | |
| Fluorochem | 100mg | 461.31 Pln | |
| Fluorochem | 250mg | 737.26 Pln | |
| Fluorochem | 1g | 1804.59 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-(1H-indol-2-yl)aniline (CAS 21889-05-4) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 4-(1H-indol-2-yl)aniline. InChIKey: BBYJHUAEFSHMHU-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 4-(1H-indol-2-yl)aniline |
| InChIKey | BBYJHUAEFSHMHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)
Synonyms:
2-(4-Aminophenyl)indole, 2-(p-Aminophenyl)indole, INDOLE, 2-(p-AMINOPHENYL)-, Benzenamine, 4-(1H-indol-2-yl)-, 5-22-11-00067 (Beilstein Handbook Reference), Benzenamine, 4-(1H-indol-2-yl)-(9CI), 4-(1H-indol-2-yl)aniline, 4-(1H-Indol-2-yl)-phenylamine, 2-(4-Aminophenyl)-1H-indole, 4-(1H-Indol-2-yl)anilin