CAS 904696-62-4 appears in our catalog under these names: 4-(1H-Pyrazol-1-ylmethyl)benzylamine hydrochloride, Tech. , (4-((1H-Pyrazol-1-yl)methyl)phenyl)methanamine hydrochloride 95+%, {4-[(1H-pyrazol-1-yl)methyl]phenyl}methanamine hydrochloride, 95+%, 95+%. Offered by: Thermo Scientific, Ambeed, Chemat. Available pack sizes: 250MG, 1g, 100mg, 5g.
[4-(pyrazol-1-ylmethyl)phenyl]methanamine;hydrochloride (CAS 904696-62-4) is a chemical compound with the molecular formula C11H14ClN3 and a molecular weight of 223.70 g/mol. IUPAC name: [4-(pyrazol-1-ylmethyl)phenyl]methanamine;hydrochloride. InChIKey: QUVMWCVEYSYIOW-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3 |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | [4-(pyrazol-1-ylmethyl)phenyl]methanamine;hydrochloride |
| InChIKey | QUVMWCVEYSYIOW-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)CC2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)