CAS 1431963-73-3 appears in our catalog under these names: [4-(3,5-Dimethyl-1h-pyrazol-1-yl)phenyl]amine hydrochloride, 95%, [4-(3,5-dimethyl-1H-pyrazol-1-yl)phenyl]amine hydrochloride. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 1g, 5g.
4-(3,5-dimethylpyrazol-1-yl)aniline;hydrochloride (CAS 1431963-73-3) is a chemical compound with the molecular formula C11H14ClN3 and a molecular weight of 223.70 g/mol. IUPAC name: 4-(3,5-dimethylpyrazol-1-yl)aniline;hydrochloride. InChIKey: OSYMFYOPIXHRMO-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3 |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | 4-(3,5-dimethylpyrazol-1-yl)aniline;hydrochloride |
| InChIKey | OSYMFYOPIXHRMO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC=C(C=C2)N)C.Cl |
Computed by PubChem (NCBI)