Products 1107604-11-4
CAS 1107604-11-4 appears in our catalog under these names: C-(1-Benzyl-1h-pyrazol-4-yl)-methylamine hydrochloride, 96%, (1-Benzyl-1H-pyrazol-4-yl)methanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
(1-benzylpyrazol-4-yl)methanamine;hydrochloride (CAS 1107604-11-4) is a chemical compound with the molecular formula C11H14ClN3 and a molecular weight of 223.70 g/mol. IUPAC name: (1-benzylpyrazol-4-yl)methanamine;hydrochloride. InChIKey: JMALFIQRGBHOSS-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3 |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | (1-benzylpyrazol-4-yl)methanamine;hydrochloride |
| InChIKey | JMALFIQRGBHOSS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C=N2)CN.Cl |
Computed by PubChem (NCBI)