CAS 138950-42-2 appears in our catalog under these names: 1,4-Dimethyl-3-phenyl-1h-pyrazol-5-amine hydrochloride, 95%, 1,4-Dimethyl-3-phenyl-1H-pyrazol-5-amine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
1,4-dimethyl-3-phenylpyrazol-5-amine;hydrochloride (CAS 138950-42-2) is a chemical compound with the molecular formula C11H14ClN3 and a molecular weight of 223.70 g/mol. IUPAC name: 1,4-dimethyl-3-phenylpyrazol-5-amine;hydrochloride. InChIKey: NVZKKJSQSHPTKI-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3 |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | 1,4-dimethyl-3-phenylpyrazol-5-amine;hydrochloride |
| InChIKey | NVZKKJSQSHPTKI-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1C2=CC=CC=C2)C)N.Cl |
Computed by PubChem (NCBI)