cas: 76579-46-9 — see every product listed under this CAS number, including other names
4-(2,2,2-Trifluoroethoxy)benzaldehyde, 95%, 95% (CAS 76579-46-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GR8D-100mg |
| cas | 76579-46-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 938.00 Pln | |
| Chemat | 5g | 2709.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(2,2,2-trifluoroethoxy)benzaldehyde (CAS 76579-46-9) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 4-(2,2,2-trifluoroethoxy)benzaldehyde. InChIKey: VQGWQLMGMVUITG-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 4-(2,2,2-trifluoroethoxy)benzaldehyde |
| InChIKey | VQGWQLMGMVUITG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)OCC(F)(F)F |
Computed by PubChem (NCBI)