cas: 81529-60-4 — see every product listed under this CAS number, including other names
4-(2,4,6-Trimethyl-phenyl)-thiazol-2-ylamine, 97% (CAS 81529-60-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F029804-100MG |
| cas | 81529-60-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 471.73 Pln | |
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 1g | 1252.70 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-amine (CAS 81529-60-4) is a chemical compound with the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. IUPAC name: 4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-amine. InChIKey: QKYORNXSXAOYPV-UHFFFAOYSA-N.
| Molecular formula | C12H14N2S |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | 4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-amine |
| InChIKey | QKYORNXSXAOYPV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=CSC(=N2)N)C |
Computed by PubChem (NCBI)