4-(2,4-Dichlorophenyl)azetidin-2-one, 95%
cas: 90273-40-8 — see every product listed under this CAS number, including other names
4-(2,4-Dichlorophenyl)azetidin-2-one, 95% (CAS 90273-40-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1032236-100mg |
| cas | 90273-40-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 609.56 Pln | |
| Ambeed | 250mg | 987.81 Pln | |
| Ambeed | 1g | 2528.62 Pln | |
| BLDpharm | 100mg | 603.15 Pln | |
| BLDpharm | 250mg | 964.13 Pln | |
| BLDpharm | 1g | 2485.82 Pln | |
| Chemat | 100mg | 558.80 Pln | |
| Chemat | 250mg | 904.40 Pln | |
| Chemat | 1g | 2334.80 Pln | |
| Fluorochem | 100mg | 1023.62 Pln | |
| Fluorochem | 250mg | 1669.22 Pln | |
| Fluorochem | 1g | 4324.54 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-(2,4-dichlorophenyl)azetidin-2-one (CAS 90273-40-8) is a chemical compound with the molecular formula C9H7Cl2NO and a molecular weight of 216.06 g/mol. IUPAC name: 4-(2,4-dichlorophenyl)azetidin-2-one. InChIKey: PWNBQPXEDKUNQZ-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO |
|---|---|
| Molecular weight | 216.06 g/mol |
| IUPAC name | 4-(2,4-dichlorophenyl)azetidin-2-one |
| InChIKey | PWNBQPXEDKUNQZ-UHFFFAOYSA-N |
| SMILES | C1C(NC1=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)