Products 2489632-40-6
CAS 2489632-40-6 is the registry number for 4-(5,6-Dichloropyridin-2-yl)but-3-yn-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(5,6-dichloro-2-pyridinyl)but-3-yn-1-ol (CAS 2489632-40-6) is a chemical compound with the molecular formula C9H7Cl2NO and a molecular weight of 216.06 g/mol. IUPAC name: 4-(5,6-dichloro-2-pyridinyl)but-3-yn-1-ol. InChIKey: YLOFCVKJEPPNIH-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO |
|---|---|
| Molecular weight | 216.06 g/mol |
| IUPAC name | 4-(5,6-dichloro-2-pyridinyl)but-3-yn-1-ol |
| InChIKey | YLOFCVKJEPPNIH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1C#CCCO)Cl)Cl |
Computed by PubChem (NCBI)