CAS 1341426-90-1 is the registry number for 6,8-Dichloro-3,4-dihydroisoquinolin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dichloro-3,4-dihydro-2H-isoquinolin-1-one (CAS 1341426-90-1) is a chemical compound with the molecular formula C9H7Cl2NO and a molecular weight of 216.06 g/mol. IUPAC name: 6,8-dichloro-3,4-dihydro-2H-isoquinolin-1-one. InChIKey: OEVOVUNCEJZHTQ-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO |
|---|---|
| Molecular weight | 216.06 g/mol |
| IUPAC name | 6,8-dichloro-3,4-dihydro-2H-isoquinolin-1-one |
| InChIKey | OEVOVUNCEJZHTQ-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C1C=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)