Products 480439-41-6
CAS 480439-41-6 appears in our catalog under these names: 2,4-Dichlorophenethyl isocyanate, 95%, 2,4-Dichloro-1-(2-isocyanatoethyl)benzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
2,4-dichloro-1-(2-isocyanatoethyl)benzene (CAS 480439-41-6) is a chemical compound with the molecular formula C9H7Cl2NO and a molecular weight of 216.06 g/mol. IUPAC name: 2,4-dichloro-1-(2-isocyanatoethyl)benzene. InChIKey: GDBPHFFZTSTTKK-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO |
|---|---|
| Molecular weight | 216.06 g/mol |
| IUPAC name | 2,4-dichloro-1-(2-isocyanatoethyl)benzene |
| InChIKey | GDBPHFFZTSTTKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CCN=C=O |
Computed by PubChem (NCBI)