cas: 793678-99-6 — see every product listed under this CAS number, including other names
4-(2,5-Dioxo-imidazolidin-1-yl)-butyric acid, 95%, 95% (CAS 793678-99-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G41H-100mg |
| cas | 793678-99-6 |
| size | 100mg |
| availability | 0.4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 813.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(2,5-dioxoimidazolidin-1-yl)butanoic acid (CAS 793678-99-6) is a chemical compound with the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. IUPAC name: 4-(2,5-dioxoimidazolidin-1-yl)butanoic acid. InChIKey: GYEHTLIBCNQARC-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O4 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 4-(2,5-dioxoimidazolidin-1-yl)butanoic acid |
| InChIKey | GYEHTLIBCNQARC-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)N1)CCCC(=O)O |
Computed by PubChem (NCBI)