CAS 16364-35-5 appears in our catalog under these names: Cyclo(-gly-glu), 95%, (S)-3-(3,6-Dioxopiperazin-2-yl)propanoic acid, 95+%, Cyclo(–Glu–Gly), Cyclo(-Gly-L-Glu), (S)-3-(3,6-Dioxopiperazin-2-yl)propanoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg, 500mg, 10mg, 25mg.
3-[(2S)-3,6-dioxopiperazin-2-yl]propanoic acid (CAS 16364-35-5) is a chemical compound with the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. IUPAC name: 3-[(2S)-3,6-dioxopiperazin-2-yl]propanoic acid. InChIKey: WFLSPLQAZRBQJX-BYPYZUCNSA-N.
| Molecular formula | C7H10N2O4 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 3-[(2S)-3,6-dioxopiperazin-2-yl]propanoic acid |
| InChIKey | WFLSPLQAZRBQJX-BYPYZUCNSA-N |
| SMILES | C1C(=O)N[C@H](C(=O)N1)CCC(=O)O |
Computed by PubChem (NCBI)