Products 19245-24-0

CAS 19245-24-0 is the registry number for Diethyl cyanoiminodicarbonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

Ethyl N-cyano-N-ethoxycarbonylcarbamate (CAS 19245-24-0) is a chemical compound with the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. IUPAC name: ethyl N-cyano-N-ethoxycarbonylcarbamate. InChIKey: MQULXGBGSVZSSN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10N2O4
Molecular weight186.17 g/mol
IUPAC nameethyl N-cyano-N-ethoxycarbonylcarbamate
InChIKeyMQULXGBGSVZSSN-UHFFFAOYSA-N
SMILESCCOC(=O)N(C#N)C(=O)OCC

Computed by PubChem (NCBI)