CAS 26972-48-5 is the registry number for (1,3-Dimethyl-2,5-dioxoimidazolidin-4-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)acetic acid (CAS 26972-48-5) is a chemical compound with the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. IUPAC name: 2-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)acetic acid. InChIKey: QFSPGSOZBQHXNU-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O4 |
|---|---|
| Molecular weight | 186.17 g/mol |
| IUPAC name | 2-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)acetic acid |
| InChIKey | QFSPGSOZBQHXNU-UHFFFAOYSA-N |
| SMILES | CN1C(C(=O)N(C1=O)C)CC(=O)O |
Computed by PubChem (NCBI)