cas: 74605-12-2 — see every product listed under this CAS number, including other names
4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine, 95%, 95% (CAS 74605-12-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119PIK-100mg |
| cas | 74605-12-2 |
| size | 100mg |
| availability | 120g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 1221.20 Pln | |
| Chemat | 10g | 2046.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine (CAS 74605-12-2) is a chemical compound with the molecular formula C11H12N2O2S and a molecular weight of 236.29 g/mol. IUPAC name: 4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine. InChIKey: FXGVKHSZIMCUTR-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | 4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine |
| InChIKey | FXGVKHSZIMCUTR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C2=CSC(=N2)N |
Computed by PubChem (NCBI)