Products 928712-24-7

CAS 928712-24-7 is the registry number for 2-[2-(Methylthio)-1h-benzimidazol-1-yl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(2-methylsulfanylbenzimidazol-1-yl)propanoic acid (CAS 928712-24-7) is a chemical compound with the molecular formula C11H12N2O2S and a molecular weight of 236.29 g/mol. IUPAC name: 2-(2-methylsulfanylbenzimidazol-1-yl)propanoic acid. InChIKey: XHNHHJSRWSRKLG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N2O2S
Molecular weight236.29 g/mol
IUPAC name2-(2-methylsulfanylbenzimidazol-1-yl)propanoic acid
InChIKeyXHNHHJSRWSRKLG-UHFFFAOYSA-N
SMILESCC(C(=O)O)N1C2=CC=CC=C2N=C1SC

Computed by PubChem (NCBI)