CAS 1031672-01-1 is the registry number for 4-Propyl-2-(1h-pyrrol-1-yl)-1,3-thiazole-5-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-propyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylic acid (CAS 1031672-01-1) is a chemical compound with the molecular formula C11H12N2O2S and a molecular weight of 236.29 g/mol. IUPAC name: 4-propyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylic acid. InChIKey: GNZDWHQVBLNDQK-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | 4-propyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylic acid |
| InChIKey | GNZDWHQVBLNDQK-UHFFFAOYSA-N |
| SMILES | CCCC1=C(SC(=N1)N2C=CC=C2)C(=O)O |
Computed by PubChem (NCBI)