CAS 68195-02-8 is the registry number for (2-Amino-benzothiazol-6-yl)-acetic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Ethyl 2-(2-amino-1,3-benzothiazol-6-yl)acetate (CAS 68195-02-8) is a chemical compound with the molecular formula C11H12N2O2S and a molecular weight of 236.29 g/mol. IUPAC name: ethyl 2-(2-amino-1,3-benzothiazol-6-yl)acetate. InChIKey: HBYRGKVSKZCQGF-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | ethyl 2-(2-amino-1,3-benzothiazol-6-yl)acetate |
| InChIKey | HBYRGKVSKZCQGF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC2=C(C=C1)N=C(S2)N |
Computed by PubChem (NCBI)