cas: 307308-81-2 — see every product listed under this CAS number, including other names
4-(2,6-Difluorophenoxy)aniline 95% (CAS 307308-81-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A723164-250mg |
| cas | 307308-81-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1204.75 Pln | |
| Ambeed | 1g | 2856.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A723164 |
4-(2,6-difluorophenoxy)aniline (CAS 307308-81-2) is a chemical compound with the molecular formula C12H9F2NO and a molecular weight of 221.20 g/mol. IUPAC name: 4-(2,6-difluorophenoxy)aniline. InChIKey: VQWLDDHBHQYMTM-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO |
|---|---|
| Molecular weight | 221.20 g/mol |
| IUPAC name | 4-(2,6-difluorophenoxy)aniline |
| InChIKey | VQWLDDHBHQYMTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)OC2=CC=C(C=C2)N)F |
Computed by PubChem (NCBI)