CAS 1375069-12-7 is the registry number for 5-(3,5-Difluorophenyl)-2-methoxypyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
5-(3,5-difluorophenyl)-2-methoxypyridine (CAS 1375069-12-7) is a chemical compound with the molecular formula C12H9F2NO and a molecular weight of 221.20 g/mol. IUPAC name: 5-(3,5-difluorophenyl)-2-methoxypyridine. InChIKey: ZVHCKOSWKRFYRQ-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO |
|---|---|
| Molecular weight | 221.20 g/mol |
| IUPAC name | 5-(3,5-difluorophenyl)-2-methoxypyridine |
| InChIKey | ZVHCKOSWKRFYRQ-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C=C1)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)