CAS 163811-28-7 appears in our catalog under these names: N-Benzoyl-2-(difluoromethyl)pyrrole, 95%, N-Benzoyl-2-(difluoromethyl)pyrrole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 25g.
[2-(difluoromethyl)pyrrol-1-yl]-phenylmethanone (CAS 163811-28-7) is a chemical compound with the molecular formula C12H9F2NO and a molecular weight of 221.20 g/mol. IUPAC name: [2-(difluoromethyl)pyrrol-1-yl]-phenylmethanone. InChIKey: MTGNPQCKYUXXEZ-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO |
|---|---|
| Molecular weight | 221.20 g/mol |
| IUPAC name | [2-(difluoromethyl)pyrrol-1-yl]-phenylmethanone |
| InChIKey | MTGNPQCKYUXXEZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N2C=CC=C2C(F)F |
Computed by PubChem (NCBI)