cas: 307308-81-2 — see every product listed under this CAS number, including other names
4-(2,6-Difluorophenoxy)aniline, 95%, 95% (CAS 307308-81-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DTO5-100mg |
| cas | 307308-81-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1442.00 Pln | |
| Chemat | 250mg | 2224.40 Pln | |
| Chemat | 1g | 4542.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(2,6-difluorophenoxy)aniline (CAS 307308-81-2) is a chemical compound with the molecular formula C12H9F2NO and a molecular weight of 221.20 g/mol. IUPAC name: 4-(2,6-difluorophenoxy)aniline. InChIKey: VQWLDDHBHQYMTM-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO |
|---|---|
| Molecular weight | 221.20 g/mol |
| IUPAC name | 4-(2,6-difluorophenoxy)aniline |
| InChIKey | VQWLDDHBHQYMTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)OC2=CC=C(C=C2)N)F |
Computed by PubChem (NCBI)